About 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one
3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one (PubChem CID 308112) has the molecular formula C10H8N2O3
and a molecular weight of 204.18 g/mol. Its IUPAC name is 3-methyl-1,2-dioxido-5-phenylpyrazole-1,2-diium-4-one.
Molecular Properties
| Compound Name | 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one |
| PubChem CID | 308112 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-methyl-1,2-dioxido-5-phenylpyrazole-1,2-diium-4-one |
| SMILES | CC1=[N+]([N+](=C(C1=O)C2=CC=CC=C2)[O-])[O-] |
| InChI | InChI=1S/C10H8N2O3/c1-7-10(13)9(12(15)11(7)14)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | KSMKASCJTRVXPR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 365 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one?
The IUPAC name of 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one (CID 308112) is 3-methyl-1,2-dioxido-5-phenylpyrazole-1,2-diium-4-one.
What is the SMILES notation for 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one?
The canonical SMILES for 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one is CC1=[N+]([N+](=C(C1=O)C2=CC=CC=C2)[O-])[O-].
What is the InChIKey of 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one?
The InChIKey is KSMKASCJTRVXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-7-10(13)9(12(15)11(7)14)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one?
3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one has a molecular weight of 204.18 g/mol, XLogP of 0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methyl-1,2-dioxo-5-phenyl-4H-1lambda~5~,2lambda~5~-pyrazol-4-one is sourced from PubChem (CID 308112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).