About 2-hydroxybenzoic acid;N-methylpyridin-3-amine
2-hydroxybenzoic acid;N-methylpyridin-3-amine (PubChem CID 3081129) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;N-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;N-methylpyridin-3-amine |
| PubChem CID | 3081129 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-hydroxybenzoic acid;N-methylpyridin-3-amine |
| SMILES | CNc1cccnc1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C6H8N2/c8-6-4-2-1-3-5(6)7(9)10;1-7-6-3-2-4-8-5-6/h1-4,8H,(H,9,10);2-5,7H,1H3 |
| InChIKey | QSCGZGTURYUXON-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;N-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;N-methylpyridin-3-amine?
The IUPAC name of 2-hydroxybenzoic acid;N-methylpyridin-3-amine (CID 3081129) is 2-hydroxybenzoic acid;N-methylpyridin-3-amine.
What is the SMILES notation for 2-hydroxybenzoic acid;N-methylpyridin-3-amine?
The canonical SMILES for 2-hydroxybenzoic acid;N-methylpyridin-3-amine is CNc1cccnc1.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;N-methylpyridin-3-amine?
The InChIKey is QSCGZGTURYUXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C6H8N2/c8-6-4-2-1-3-5(6)7(9)10;1-7-6-3-2-4-8-5-6/h1-4,8H,(H,9,10);2-5,7H,1H3.
What are the key properties of 2-hydroxybenzoic acid;N-methylpyridin-3-amine?
2-hydroxybenzoic acid;N-methylpyridin-3-amine has a molecular weight of 246.27 g/mol, XLogP of 2.21, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;N-methylpyridin-3-amine is sourced from PubChem (CID 3081129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).