C24H33IO2 — CID 3081219
(8R,9S,10R,13S,14S)-17-hydroxy-17-(6-(125I)iodohex-1-ynyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 3081219) has the molecular formula C24H33IO2 and a molecular weight of 478.43 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-hydroxy-17-(6-(125I)iodohex-1-ynyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-17-hydroxy-17-(6-(125I)iodohex-1-ynyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 3081219 |
| Molecular Formula | C24H33IO2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-hydroxy-17-(6-(125I)iodohex-1-ynyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1CCC2(O)C#CCCCC[125I] |
| InChI | InChI=1S/C24H33IO2/c1-23-13-10-20-19-9-7-18(26)16-17(19)6-8-21(20)22(23)11-14-24(23,27)12-4-2-3-5-15-25/h16,19-22,27H,2-3,5-11,13-15H2,1H3/t19-,20+,21+,22-,23-,24?/m0/s1/i25-2 |
| InChIKey | ATOABPRAPSWSDS-CRUYFKLESA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|