C14H20FN5O7S — CID 3081239
3-(2-aminoethyl)-7-fluoro-1H-indole-5,6-diol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid (PubChem CID 3081239) has the molecular formula C14H20FN5O7S and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-(2-aminoethyl)-7-fluoro-1H-indole-5,6-diol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid.
| Compound Name | 3-(2-aminoethyl)-7-fluoro-1H-indole-5,6-diol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid |
|---|---|
| PubChem CID | 3081239 |
| Molecular Formula | C14H20FN5O7S |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-(2-aminoethyl)-7-fluoro-1H-indole-5,6-diol;2-amino-3-methyl-4H-imidazol-5-one;sulfuric acid |
| SMILES | CN1CC(=O)N=C1N.NCCc1c[nH]c2c(F)c(O)c(O)cc12.O=S(=O)(O)O |
| InChI | InChI=1S/C10H11FN2O2.C4H7N3O.H2O4S/c11-8-9-6(3-7(14)10(8)15)5(1-2-12)4-13-9;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h3-4,13-15H,1-2,12H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4) |
| InChIKey | QWLPHRORYKWBHE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 215.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|