About 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide
2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide (PubChem CID 3081324) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide |
| PubChem CID | 3081324 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)O.C=CC(=O)NC(C)C |
| InChI | InChI=1S/C6H11NO.C4H6O2/c1-4-6(8)7-5(2)3;1-3(2)4(5)6/h4-5H,1H2,2-3H3,(H,7,8);1H2,2H3,(H,5,6) |
| InChIKey | BGJOTKHBFYMJST-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide?
The IUPAC name of 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide (CID 3081324) is 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide.
What is the SMILES notation for 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide?
The canonical SMILES for 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide is C=C(C)C(=O)O.C=CC(=O)NC(C)C.
What is the InChIKey of 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide?
The InChIKey is BGJOTKHBFYMJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H6O2/c1-4-6(8)7-5(2)3;1-3(2)4(5)6/h4-5H,1H2,2-3H3,(H,7,8);1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide?
2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide has a molecular weight of 199.25 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;N-propan-2-ylprop-2-enamide is sourced from PubChem (CID 3081324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).