C16H19FO6 — CID 3081511
[(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl] benzoate (PubChem CID 3081511) has the molecular formula C16H19FO6 and a molecular weight of 326.32 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl] benzoate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl] benzoate |
|---|---|
| PubChem CID | 3081511 |
| Molecular Formula | C16H19FO6 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)COC(=O)c3ccccc3)[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C16H19FO6/c1-16(2)22-13-11(17)12(21-15(13)23-16)10(18)8-20-14(19)9-6-4-3-5-7-9/h3-7,10-13,15,18H,8H2,1-2H3/t10-,11+,12-,13-,15-/m1/s1 |
| InChIKey | KWTCJBZBPXSFRW-WPLOAARJSA-N |
| XLogP | 1.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |