C23H18N2O4S — CID 30819143
[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 30819143) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 30819143 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1cccc(NC(=O)c2cccs2)c1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H18N2O4S/c1-14(21(26)18-13-24-19-9-3-2-8-17(18)19)29-23(28)15-6-4-7-16(12-15)25-22(27)20-10-5-11-30-20/h2-14,24H,1H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | SNMLBOZQFSKAGN-CQSZACIVSA-N |
| XLogP | 4.91 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |