C23H24FN3O5 — CID 3081915
3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 3081915) has the molecular formula C23H24FN3O5 and a molecular weight of 441.46 g/mol. Its IUPAC name is 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 3081915 |
| Molecular Formula | C23H24FN3O5 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)OCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C23H24FN3O5/c24-16-2-4-18-20(12-16)32-26-22(18)15-6-9-27(10-7-15)8-1-11-29-23(28)25-17-3-5-19-21(13-17)31-14-30-19/h2-5,12-13,15H,1,6-11,14H2,(H,25,28) |
| InChIKey | ZEMJDGPKDOUEEZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|