C7H13N3O4 — CID 3082172
(2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol (PubChem CID 3082172) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol.
| Compound Name | (2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 3082172 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13N3O4/c1-3-4(9-10-8)5(11)6(12)7(13-2)14-3/h3-7,11-12H,1-2H3/t3-,4-,5+,6+,7+/m1/s1 |
| InChIKey | PKXUFEYHGZHRPK-VEIUFWFVSA-N |
| XLogP | -0.22 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|