About benzene-1,4-diol;formaldehyde
benzene-1,4-diol;formaldehyde (PubChem CID 3082254) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is benzene-1,4-diol;formaldehyde.
Molecular Properties
| Compound Name | benzene-1,4-diol;formaldehyde |
| PubChem CID | 3082254 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | benzene-1,4-diol;formaldehyde |
| SMILES | C=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.CH2O/c7-5-1-2-6(8)4-3-5;1-2/h1-4,7-8H;1H2 |
| InChIKey | UREVLELSVZQJTM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;formaldehyde?
The IUPAC name of benzene-1,4-diol;formaldehyde (CID 3082254) is benzene-1,4-diol;formaldehyde.
What is the SMILES notation for benzene-1,4-diol;formaldehyde?
The canonical SMILES for benzene-1,4-diol;formaldehyde is C=O.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;formaldehyde?
The InChIKey is UREVLELSVZQJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.CH2O/c7-5-1-2-6(8)4-3-5;1-2/h1-4,7-8H;1H2.
What are the key properties of benzene-1,4-diol;formaldehyde?
benzene-1,4-diol;formaldehyde has a molecular weight of 140.14 g/mol, XLogP of 0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;formaldehyde is sourced from PubChem (CID 3082254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).