C15H12ClN3O5 — CID 30822885
[(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-nitrobenzoate (PubChem CID 30822885) has the molecular formula C15H12ClN3O5 and a molecular weight of 349.73 g/mol. Its IUPAC name is [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-nitrobenzoate.
| Compound Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 30822885 |
| Molecular Formula | C15H12ClN3O5 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H12ClN3O5/c1-9(14(20)18-13-7-6-10(16)8-17-13)24-15(21)11-4-2-3-5-12(11)19(22)23/h2-9H,1H3,(H,17,18,20)/t9-/m1/s1 |
| InChIKey | MBNFWFPPAJNEBQ-SECBINFHSA-N |
| XLogP | 2.83 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|