C17H20N2O3 — CID 30822933
N-[[(2S)-oxolan-2-yl]methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 30822933) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 30822933 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2)o1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H20N2O3/c20-16(18-11-14-7-4-10-21-14)8-9-17-19-12-15(22-17)13-5-2-1-3-6-13/h1-3,5-6,12,14H,4,7-11H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | MBRZSOPCBQEWRV-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |