About 6-(4-Nitrophenyl)-2,4-diphenylverdazyl
6-(4-Nitrophenyl)-2,4-diphenylverdazyl (PubChem CID 3082339) has the molecular formula C20H16N5O2
and a molecular weight of 358.38 g/mol.
Molecular Properties
| Compound Name | 6-(4-Nitrophenyl)-2,4-diphenylverdazyl |
| PubChem CID | 3082339 |
| Molecular Formula | C20H16N5O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)CN(c3ccccc3)[N]2)cc1 |
| InChI | InChI=1S/C20H16N5O2/c26-25(27)19-13-11-16(12-14-19)20-21-23(17-7-3-1-4-8-17)15-24(22-20)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | UKPWQAIIVKAFCL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-Nitrophenyl)-2,4-diphenylverdazyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-Nitrophenyl)-2,4-diphenylverdazyl?
The IUPAC name of 6-(4-Nitrophenyl)-2,4-diphenylverdazyl (CID 3082339) is not available.
What is the SMILES notation for 6-(4-Nitrophenyl)-2,4-diphenylverdazyl?
The canonical SMILES for 6-(4-Nitrophenyl)-2,4-diphenylverdazyl is O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)CN(c3ccccc3)[N]2)cc1.
What is the InChIKey of 6-(4-Nitrophenyl)-2,4-diphenylverdazyl?
The InChIKey is UKPWQAIIVKAFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N5O2/c26-25(27)19-13-11-16(12-14-19)20-21-23(17-7-3-1-4-8-17)15-24(22-20)18-9-5-2-6-10-18/h1-14H,15H2.
What are the key properties of 6-(4-Nitrophenyl)-2,4-diphenylverdazyl?
6-(4-Nitrophenyl)-2,4-diphenylverdazyl has a molecular weight of 358.38 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-Nitrophenyl)-2,4-diphenylverdazyl is sourced from PubChem (CID 3082339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).