C26H29N3O4S — CID 30825059
3-methyl-N-[(2R)-3-methyl-1-[2-[4-(4-methylphenyl)sulfonylphenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 30825059) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-3-methyl-1-[2-[4-(4-methylphenyl)sulfonylphenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(2R)-3-methyl-1-[2-[4-(4-methylphenyl)sulfonylphenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 30825059 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 3-methyl-N-[(2R)-3-methyl-1-[2-[4-(4-methylphenyl)sulfonylphenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(NNC(=O)[C@H](NC(=O)c3cccc(C)c3)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O4S/c1-17(2)24(27-25(30)20-7-5-6-19(4)16-20)26(31)29-28-21-10-14-23(15-11-21)34(32,33)22-12-8-18(3)9-13-22/h5-17,24,28H,1-4H3,(H,27,30)(H,29,31)/t24-/m1/s1 |
| InChIKey | PHIWFSPUFIYCPL-XMMPIXPASA-N |
| XLogP | 4.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|