C18H20O7 — CID 3082526
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-naphthalen-1-ylacetate (PubChem CID 3082526) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 3082526 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H20O7/c19-9-13-15(21)16(22)17(23)18(24-13)25-14(20)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13,15-19,21-23H,8-9H2/t13-,15-,16+,17-,18+/m1/s1 |
| InChIKey | GSDPAPPLJYQPKZ-LHKMKVQPSA-N |
| XLogP | -0.27 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |