C12H11N5O — CID 3082810
4-(furan-2-yl)-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine (PubChem CID 3082810) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-(furan-2-yl)-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine.
| Compound Name | 4-(furan-2-yl)-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine |
|---|---|
| PubChem CID | 3082810 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-(furan-2-yl)-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine |
| SMILES | Nc1nc2c(c3nc(-c4ccco4)nn13)CCC2 |
| InChI | InChI=1S/C12H11N5O/c13-12-14-8-4-1-3-7(8)11-15-10(16-17(11)12)9-5-2-6-18-9/h2,5-6H,1,3-4H2,(H2,13,14) |
| InChIKey | XCXUDZMZHGNHKF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |