About 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid
2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid (PubChem CID 3082879) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid |
| PubChem CID | 3082879 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid |
| SMILES | NC(Cc1cnn2ccccc12)C(=O)O |
| InChI | InChI=1S/C10H11N3O2/c11-8(10(14)15)5-7-6-12-13-4-2-1-3-9(7)13/h1-4,6,8H,5,11H2,(H,14,15) |
| InChIKey | KPOIYQLWQBUZIS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid?
The IUPAC name of 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid (CID 3082879) is 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid.
What is the SMILES notation for 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid?
The canonical SMILES for 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid is NC(Cc1cnn2ccccc12)C(=O)O.
What is the InChIKey of 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid?
The InChIKey is KPOIYQLWQBUZIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c11-8(10(14)15)5-7-6-12-13-4-2-1-3-9(7)13/h1-4,6,8H,5,11H2,(H,14,15).
What are the key properties of 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid?
2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid has a molecular weight of 205.22 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-pyrazolo[1,5-a]pyridin-3-ylpropanoic acid is sourced from PubChem (CID 3082879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).