About 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid
7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid (PubChem CID 3082944) has the molecular formula C19H36O2S
and a molecular weight of 328.56 g/mol. Its IUPAC name is 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid |
| PubChem CID | 3082944 |
| Molecular Formula | C19H36O2S |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid |
| SMILES | CCCCCCCC[C@H]1CSC[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2S/c1-2-3-4-5-6-9-12-17-15-22-16-18(17)13-10-7-8-11-14-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1 |
| InChIKey | FMASGJQNTVAHSF-ROUUACIJSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The IUPAC name of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid (CID 3082944) is 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid.
What is the SMILES notation for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The canonical SMILES for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid is CCCCCCCC[C@H]1CSC[C@@H]1CCCCCCC(=O)O.
What is the InChIKey of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The InChIKey is FMASGJQNTVAHSF-ROUUACIJSA-N. The full InChI is InChI=1S/C19H36O2S/c1-2-3-4-5-6-9-12-17-15-22-16-18(17)13-10-7-8-11-14-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1.
What are the key properties of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid has a molecular weight of 328.56 g/mol, XLogP of 6.14, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid is sourced from PubChem (CID 3082944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).