7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid

C19H36O2S — CID 3082944

IUPAC7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid
SMILESCCCCCCCC[C@H]1CSC[C@@H]1CCCCCCC(=O)O
InChIInChI=1S/C19H36O2S/c1-2-3-4-5-6-9-12-17-15-22-16-18(17)13-10-7-8-11-14-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1
InChIKeyFMASGJQNTVAHSF-ROUUACIJSA-N
MW328.56 g/mol
LogP6.14
Rot. Bonds14

About 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid

7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid (PubChem CID 3082944) has the molecular formula C19H36O2S and a molecular weight of 328.56 g/mol. Its IUPAC name is 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid.

Molecular Properties

Compound Name7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid
PubChem CID3082944
Molecular FormulaC19H36O2S
Molecular Weight328.56 g/mol
Exact Mass328.24
IUPAC Name7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid
SMILESCCCCCCCC[C@H]1CSC[C@@H]1CCCCCCC(=O)O
InChIInChI=1S/C19H36O2S/c1-2-3-4-5-6-9-12-17-15-22-16-18(17)13-10-7-8-11-14-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1
InChIKeyFMASGJQNTVAHSF-ROUUACIJSA-N
XLogP6.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500328.56
LogP ≤ 56.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The IUPAC name of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid (CID 3082944) is 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid.
What is the SMILES notation for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The canonical SMILES for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid is CCCCCCCC[C@H]1CSC[C@@H]1CCCCCCC(=O)O.
What is the InChIKey of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
The InChIKey is FMASGJQNTVAHSF-ROUUACIJSA-N. The full InChI is InChI=1S/C19H36O2S/c1-2-3-4-5-6-9-12-17-15-22-16-18(17)13-10-7-8-11-14-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1.
What are the key properties of 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid?
7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid has a molecular weight of 328.56 g/mol, XLogP of 6.14, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3R,4R)-4-octylthiolan-3-yl]heptanoic acid is sourced from PubChem (CID 3082944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).