C19H19NO — CID 3083157
(6aR)-6-prop-2-enyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol (PubChem CID 3083157) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (6aR)-6-prop-2-enyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol.
| Compound Name | (6aR)-6-prop-2-enyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
|---|---|
| PubChem CID | 3083157 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (6aR)-6-prop-2-enyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
| SMILES | C=CCN1CCc2cccc3c2[C@H]1Cc1cccc(O)c1-3 |
| InChI | InChI=1S/C19H19NO/c1-2-10-20-11-9-13-5-3-7-15-18(13)16(20)12-14-6-4-8-17(21)19(14)15/h2-8,16,21H,1,9-12H2/t16-/m1/s1 |
| InChIKey | AUVXRDCLWMODQH-MRXNPFEDSA-N |
| XLogP | 3.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|