About benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline
benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline (PubChem CID 3083160) has the molecular formula C20H17CuN2S
and a molecular weight of 380.98 g/mol. Its IUPAC name is benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline.
Molecular Properties
| Compound Name | benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline |
| PubChem CID | 3083160 |
| Molecular Formula | C20H17CuN2S |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.[Cu+].[S-]c1ccccc1 |
| InChI | InChI=1S/C14H12N2.C6H6S.Cu/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;7-6-4-2-1-3-5-6;/h3-8H,1-2H3;1-5,7H;/q;;+1/p-1 |
| InChIKey | JYJJHLVBPPUMLN-UHFFFAOYSA-M |
| XLogP | 4.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline?
The IUPAC name of benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline (CID 3083160) is benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline.
What is the SMILES notation for benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline?
The canonical SMILES for benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline is Cc1ccc2ccc3ccc(C)nc3c2n1.[Cu+].[S-]c1ccccc1.
What is the InChIKey of benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline?
The InChIKey is JYJJHLVBPPUMLN-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12N2.C6H6S.Cu/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;7-6-4-2-1-3-5-6;/h3-8H,1-2H3;1-5,7H;/q;;+1/p-1.
What are the key properties of benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline?
benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline has a molecular weight of 380.98 g/mol, XLogP of 4.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiolate;copper(1+);2,9-dimethyl-1,10-phenanthroline is sourced from PubChem (CID 3083160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).