C19H26N4O4 — CID 30832492
N-[(2-ethoxy-3-pyridinyl)methyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 30832492) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(2-ethoxy-3-pyridinyl)methyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[(2-ethoxy-3-pyridinyl)methyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 30832492 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[(2-ethoxy-3-pyridinyl)methyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCOc1ncccc1CNC(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H26N4O4/c1-3-27-16-14(8-6-10-20-16)11-21-15(24)12-23-17(25)19(22-18(23)26)9-5-4-7-13(19)2/h6,8,10,13H,3-5,7,9,11-12H2,1-2H3,(H,21,24)(H,22,26)/t13-,19-/m0/s1 |
| InChIKey | AJJDSLGSEATAGT-DJJJIMSYSA-N |
| XLogP | 1.60 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|