C18H16N4O2S — CID 30833582
N-(cyanomethyl)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-phenylacetamide (PubChem CID 30833582) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 30833582 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(cyanomethyl)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-phenylacetamide |
| SMILES | Cc1sc2ncn(CC(=O)N(CC#N)c3ccccc3)c(=O)c2c1C |
| InChI | InChI=1S/C18H16N4O2S/c1-12-13(2)25-17-16(12)18(24)21(11-20-17)10-15(23)22(9-8-19)14-6-4-3-5-7-14/h3-7,11H,9-10H2,1-2H3 |
| InChIKey | CXZMAZWJGUVHFL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|