C23H27N3O4 — CID 30834010
N-(2,6-dimethylphenyl)-2-[4-[2-(2-formylphenoxy)acetyl]piperazin-1-yl]acetamide (PubChem CID 30834010) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[2-(2-formylphenoxy)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[2-(2-formylphenoxy)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30834010 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[2-(2-formylphenoxy)acetyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)COc2ccccc2C=O)CC1 |
| InChI | InChI=1S/C23H27N3O4/c1-17-6-5-7-18(2)23(17)24-21(28)14-25-10-12-26(13-11-25)22(29)16-30-20-9-4-3-8-19(20)15-27/h3-9,15H,10-14,16H2,1-2H3,(H,24,28) |
| InChIKey | SCQRJEYRHWNJSM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|