C22H28N2O4 — CID 30834684
N-[(2S)-2-(3-methoxyphenyl)-2-morpholin-4-ylethyl]-2-(4-methylphenoxy)acetamide (PubChem CID 30834684) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(2S)-2-(3-methoxyphenyl)-2-morpholin-4-ylethyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(2S)-2-(3-methoxyphenyl)-2-morpholin-4-ylethyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 30834684 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[(2S)-2-(3-methoxyphenyl)-2-morpholin-4-ylethyl]-2-(4-methylphenoxy)acetamide |
| SMILES | COc1cccc([C@@H](CNC(=O)COc2ccc(C)cc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-17-6-8-19(9-7-17)28-16-22(25)23-15-21(24-10-12-27-13-11-24)18-4-3-5-20(14-18)26-2/h3-9,14,21H,10-13,15-16H2,1-2H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | PTPOSAUJZMHXFJ-OAQYLSRUSA-N |
| XLogP | 2.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |