About 10H-phenoselenazine
10H-phenoselenazine (PubChem CID 3083559) has the molecular formula C12H9NSe
and a molecular weight of 246.17 g/mol. Its IUPAC name is 10H-phenoselenazine.
Molecular Properties
| Compound Name | 10H-phenoselenazine |
| PubChem CID | 3083559 |
| Molecular Formula | C12H9NSe |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 10H-phenoselenazine |
| SMILES | c1ccc2c(c1)Nc1ccccc1[Se]2 |
| InChI | InChI=1S/C12H9NSe/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | ILFYOWGJBKEMSK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenoselenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenoselenazine?
The IUPAC name of 10H-phenoselenazine (CID 3083559) is 10H-phenoselenazine.
What is the SMILES notation for 10H-phenoselenazine?
The canonical SMILES for 10H-phenoselenazine is c1ccc2c(c1)Nc1ccccc1[Se]2.
What is the InChIKey of 10H-phenoselenazine?
The InChIKey is ILFYOWGJBKEMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NSe/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H.
What are the key properties of 10H-phenoselenazine?
10H-phenoselenazine has a molecular weight of 246.17 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenoselenazine is sourced from PubChem (CID 3083559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).