C12H12Br2N2O2 — CID 3083607
5-(1,2-dibromo-2-phenylethyl)-5-methylimidazolidine-2,4-dione (PubChem CID 3083607) has the molecular formula C12H12Br2N2O2 and a molecular weight of 376.05 g/mol. Its IUPAC name is 5-(1,2-dibromo-2-phenylethyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,2-dibromo-2-phenylethyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3083607 |
| Molecular Formula | C12H12Br2N2O2 |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 5-(1,2-dibromo-2-phenylethyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C(Br)C(Br)c2ccccc2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12Br2N2O2/c1-12(10(17)15-11(18)16-12)9(14)8(13)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H2,15,16,17,18) |
| InChIKey | OVMOGYOGBCHGHY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|