About 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one
9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 3083726) has the molecular formula C12H8O5
and a molecular weight of 232.19 g/mol. Its IUPAC name is 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
| PubChem CID | 3083726 |
| Molecular Formula | C12H8O5 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2c(O)c2oc(=O)ccc12 |
| InChI | InChI=1S/C12H8O5/c1-15-10-6-2-3-8(13)17-12(6)9(14)11-7(10)4-5-16-11/h2-5,14H,1H3 |
| InChIKey | MVJHUMZXIJPVHV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one?
The IUPAC name of 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one (CID 3083726) is 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one?
The canonical SMILES for 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one is COc1c2ccoc2c(O)c2oc(=O)ccc12.
What is the InChIKey of 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one?
The InChIKey is MVJHUMZXIJPVHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O5/c1-15-10-6-2-3-8(13)17-12(6)9(14)11-7(10)4-5-16-11/h2-5,14H,1H3.
What are the key properties of 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one?
9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one has a molecular weight of 232.19 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 3083726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).