C12H16N4O7 — CID 3083753
6-methyl-8-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4,7-trione (PubChem CID 3083753) has the molecular formula C12H16N4O7 and a molecular weight of 328.28 g/mol. Its IUPAC name is 6-methyl-8-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4,7-trione.
| Compound Name | 6-methyl-8-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4,7-trione |
|---|---|
| PubChem CID | 3083753 |
| Molecular Formula | C12H16N4O7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-methyl-8-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4,7-trione |
| SMILES | Cc1nc2c(=O)[nH]c(=O)[nH]c2n(C[C@@H](O)[C@@H](O)[C@@H](O)CO)c1=O |
| InChI | InChI=1S/C12H16N4O7/c1-4-11(22)16(2-5(18)8(20)6(19)3-17)9-7(13-4)10(21)15-12(23)14-9/h5-6,8,17-20H,2-3H2,1H3,(H2,14,15,21,23)/t5-,6+,8-/m1/s1 |
| InChIKey | QCYVUUAIJUUUPI-GKROBHDKSA-N |
| XLogP | -3.84 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |