C14H12N4O5 — CID 3083806
4-amino-2-hydroxybenzoic acid;5-pyridin-4-yl-3H-1,3,4-oxadiazol-2-one (PubChem CID 3083806) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-amino-2-hydroxybenzoic acid;5-pyridin-4-yl-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 4-amino-2-hydroxybenzoic acid;5-pyridin-4-yl-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 3083806 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-amino-2-hydroxybenzoic acid;5-pyridin-4-yl-3H-1,3,4-oxadiazol-2-one |
| SMILES | Nc1ccc(C(=O)O)c(O)c1.O=c1[nH]nc(-c2ccncc2)o1 |
| InChI | InChI=1S/C7H5N3O2.C7H7NO3/c11-7-10-9-6(12-7)5-1-3-8-4-2-5;8-4-1-2-5(7(10)11)6(9)3-4/h1-4H,(H,10,11);1-3,9H,8H2,(H,10,11) |
| InChIKey | JEESEUTVYFCIFM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|