About 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate
2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate (PubChem CID 3083861) has the molecular formula C9H10BF4NO
and a molecular weight of 234.99 g/mol. Its IUPAC name is 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate |
| PubChem CID | 3083861 |
| Molecular Formula | C9H10BF4NO |
| Molecular Weight | 234.99 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate |
| SMILES | CC[n+]1cc2ccccc2o1.F[B-](F)(F)F |
| InChI | InChI=1S/C9H10NO.BF4/c1-2-10-7-8-5-3-4-6-9(8)11-10;2-1(3,4)5/h3-7H,2H2,1H3;/q+1;-1 |
| InChIKey | OQZKECHXPFSOMI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.99 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate?
The IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate (CID 3083861) is 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate.
What is the SMILES notation for 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate?
The canonical SMILES for 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate is CC[n+]1cc2ccccc2o1.F[B-](F)(F)F.
What is the InChIKey of 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate?
The InChIKey is OQZKECHXPFSOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10NO.BF4/c1-2-10-7-8-5-3-4-6-9(8)11-10;2-1(3,4)5/h3-7H,2H2,1H3;/q+1;-1.
What are the key properties of 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate?
2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate has a molecular weight of 234.99 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2-benzoxazol-2-ium tetrafluoroborate is sourced from PubChem (CID 3083861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).