About 4-methoxybenzene-1,3-diol
4-methoxybenzene-1,3-diol (PubChem CID 3083936) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 4-methoxybenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-methoxybenzene-1,3-diol |
| PubChem CID | 3083936 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 4-methoxybenzene-1,3-diol |
| SMILES | COc1ccc(O)cc1O |
| InChI | InChI=1S/C7H8O3/c1-10-7-3-2-5(8)4-6(7)9/h2-4,8-9H,1H3 |
| InChIKey | GPJJASIJVRXZFI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxybenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzene-1,3-diol?
The IUPAC name of 4-methoxybenzene-1,3-diol (CID 3083936) is 4-methoxybenzene-1,3-diol.
What is the SMILES notation for 4-methoxybenzene-1,3-diol?
The canonical SMILES for 4-methoxybenzene-1,3-diol is COc1ccc(O)cc1O.
What is the InChIKey of 4-methoxybenzene-1,3-diol?
The InChIKey is GPJJASIJVRXZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-10-7-3-2-5(8)4-6(7)9/h2-4,8-9H,1H3.
What are the key properties of 4-methoxybenzene-1,3-diol?
4-methoxybenzene-1,3-diol has a molecular weight of 140.14 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzene-1,3-diol is sourced from PubChem (CID 3083936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).