About 1-(3,3-diphenylpropyl)azepane;hydrochloride
1-(3,3-diphenylpropyl)azepane;hydrochloride (PubChem CID 3084164) has the molecular formula C21H28ClN
and a molecular weight of 329.92 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)azepane;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,3-diphenylpropyl)azepane;hydrochloride |
| PubChem CID | 3084164 |
| Molecular Formula | C21H28ClN |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(3,3-diphenylpropyl)azepane;hydrochloride |
| SMILES | Cl.c1ccc(C(CCN2CCCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N.ClH/c1-2-10-17-22(16-9-1)18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20;/h3-8,11-14,21H,1-2,9-10,15-18H2;1H |
| InChIKey | FQPKTVQUKHWXFF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-diphenylpropyl)azepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diphenylpropyl)azepane;hydrochloride?
The IUPAC name of 1-(3,3-diphenylpropyl)azepane;hydrochloride (CID 3084164) is 1-(3,3-diphenylpropyl)azepane;hydrochloride.
What is the SMILES notation for 1-(3,3-diphenylpropyl)azepane;hydrochloride?
The canonical SMILES for 1-(3,3-diphenylpropyl)azepane;hydrochloride is Cl.c1ccc(C(CCN2CCCCCC2)c2ccccc2)cc1.
What is the InChIKey of 1-(3,3-diphenylpropyl)azepane;hydrochloride?
The InChIKey is FQPKTVQUKHWXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N.ClH/c1-2-10-17-22(16-9-1)18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20;/h3-8,11-14,21H,1-2,9-10,15-18H2;1H.
What are the key properties of 1-(3,3-diphenylpropyl)azepane;hydrochloride?
1-(3,3-diphenylpropyl)azepane;hydrochloride has a molecular weight of 329.92 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diphenylpropyl)azepane;hydrochloride is sourced from PubChem (CID 3084164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).