C19H13NO5 — CID 3084224
18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,12,14,16,18-octaen-11-one (PubChem CID 3084224) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is 18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,12,14,16,18-octaen-11-one.
| Compound Name | 18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,12,14,16,18-octaen-11-one |
|---|---|
| PubChem CID | 3084224 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,12,14,16,18-octaen-11-one |
| SMILES | COc1cc2ccnc3c2c(c1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C19H13NO5/c1-22-14-5-9-3-4-20-17-15(9)16(19(14)23-2)10-6-12-13(25-8-24-12)7-11(10)18(17)21/h3-7H,8H2,1-2H3 |
| InChIKey | NFDVJYPMLVMXRR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |