About tetrabutylazanium;tetraphenylboranuide
tetrabutylazanium;tetraphenylboranuide (PubChem CID 3084234) has the molecular formula C40H56BN
and a molecular weight of 561.71 g/mol. Its IUPAC name is tetrabutylazanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | tetrabutylazanium;tetraphenylboranuide |
| PubChem CID | 3084234 |
| Molecular Formula | C40H56BN |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.45 |
| IUPAC Name | tetrabutylazanium;tetraphenylboranuide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C16H36N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-20H;5-16H2,1-4H3/q-1;+1 |
| InChIKey | ZHCCBGAUZWZGQV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;tetraphenylboranuide?
The IUPAC name of tetrabutylazanium;tetraphenylboranuide (CID 3084234) is tetrabutylazanium;tetraphenylboranuide.
What is the SMILES notation for tetrabutylazanium;tetraphenylboranuide?
The canonical SMILES for tetrabutylazanium;tetraphenylboranuide is CCCC[N+](CCCC)(CCCC)CCCC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetrabutylazanium;tetraphenylboranuide?
The InChIKey is ZHCCBGAUZWZGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C16H36N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-20H;5-16H2,1-4H3/q-1;+1.
What are the key properties of tetrabutylazanium;tetraphenylboranuide?
tetrabutylazanium;tetraphenylboranuide has a molecular weight of 561.71 g/mol, XLogP of 8.07, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;tetraphenylboranuide is sourced from PubChem (CID 3084234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).