C18H24N2O2 — CID 30843324
N-(2,6-diethylphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide (PubChem CID 30843324) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide.
| Compound Name | N-(2,6-diethylphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 30843324 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(2,6-diethylphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CCc1c(C)noc1C |
| InChI | InChI=1S/C18H24N2O2/c1-5-14-8-7-9-15(6-2)18(14)19-17(21)11-10-16-12(3)20-22-13(16)4/h7-9H,5-6,10-11H2,1-4H3,(H,19,21) |
| InChIKey | AHKDNRMAFZFGEO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |