C18H16Cl4N2O3 — CID 3084599
7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;2,2,2-trichloroethane-1,1-diol (PubChem CID 3084599) has the molecular formula C18H16Cl4N2O3 and a molecular weight of 450.15 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;2,2,2-trichloroethane-1,1-diol.
| Compound Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 3084599 |
| Molecular Formula | C18H16Cl4N2O3 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;2,2,2-trichloroethane-1,1-diol |
| SMILES | CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H13ClN2O.C2H3Cl3O2/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11;3-2(4,5)1(6)7/h2-9H,10H2,1H3;1,6-7H |
| InChIKey | SDWAACKJISOIGZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|