C17H9N9O12 — CID 3084686
2-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine (PubChem CID 3084686) has the molecular formula C17H9N9O12 and a molecular weight of 531.31 g/mol. Its IUPAC name is 2-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 3084686 |
| Molecular Formula | C17H9N9O12 |
| Molecular Weight | 531.31 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 2-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2cccc(Nc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3[N+](=O)[O-])n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H9N9O12/c27-21(28)8-4-10(23(31)32)16(11(5-8)24(33)34)19-14-2-1-3-15(18-14)20-17-12(25(35)36)6-9(22(29)30)7-13(17)26(37)38/h1-7H,(H2,18,19,20) |
| InChIKey | GPFSORASRNHLMZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 295.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|