About 2,2-diethoxy-1,2-diphenylethanone
2,2-diethoxy-1,2-diphenylethanone (PubChem CID 3084853) has the molecular formula C18H20O3
and a molecular weight of 284.35 g/mol. Its IUPAC name is 2,2-diethoxy-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2,2-diethoxy-1,2-diphenylethanone |
| PubChem CID | 3084853 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2,2-diethoxy-1,2-diphenylethanone |
| SMILES | CCOC(OCC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-3-20-18(21-4-2,16-13-9-6-10-14-16)17(19)15-11-7-5-8-12-15/h5-14H,3-4H2,1-2H3 |
| InChIKey | GIMQKKFOOYOQGB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxy-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxy-1,2-diphenylethanone?
The IUPAC name of 2,2-diethoxy-1,2-diphenylethanone (CID 3084853) is 2,2-diethoxy-1,2-diphenylethanone.
What is the SMILES notation for 2,2-diethoxy-1,2-diphenylethanone?
The canonical SMILES for 2,2-diethoxy-1,2-diphenylethanone is CCOC(OCC)(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2-diethoxy-1,2-diphenylethanone?
The InChIKey is GIMQKKFOOYOQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-3-20-18(21-4-2,16-13-9-6-10-14-16)17(19)15-11-7-5-8-12-15/h5-14H,3-4H2,1-2H3.
What are the key properties of 2,2-diethoxy-1,2-diphenylethanone?
2,2-diethoxy-1,2-diphenylethanone has a molecular weight of 284.35 g/mol, XLogP of 3.80, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxy-1,2-diphenylethanone is sourced from PubChem (CID 3084853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).