About 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one
7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one (PubChem CID 3084918) has the molecular formula C29H27N3O2
and a molecular weight of 449.55 g/mol. Its IUPAC name is 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one |
| PubChem CID | 3084918 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one |
| SMILES | CCn1c(C)c(C2(c3c(C)n(CC)c4ccccc34)OC(=O)c3cccnc32)c2ccccc21 |
| InChI | InChI=1S/C29H27N3O2/c1-5-31-18(3)25(20-12-7-9-15-23(20)31)29(27-22(28(33)34-29)14-11-17-30-27)26-19(4)32(6-2)24-16-10-8-13-21(24)26/h7-17H,5-6H2,1-4H3 |
| InChIKey | JUXGNHBXUWJEHI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one?
The IUPAC name of 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one (CID 3084918) is 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one.
What is the SMILES notation for 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one?
The canonical SMILES for 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one is CCn1c(C)c(C2(c3c(C)n(CC)c4ccccc34)OC(=O)c3cccnc32)c2ccccc21.
What is the InChIKey of 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one?
The InChIKey is JUXGNHBXUWJEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N3O2/c1-5-31-18(3)25(20-12-7-9-15-23(20)31)29(27-22(28(33)34-29)14-11-17-30-27)26-19(4)32(6-2)24-16-10-8-13-21(24)26/h7-17H,5-6H2,1-4H3.
What are the key properties of 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one?
7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one has a molecular weight of 449.55 g/mol, XLogP of 6.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-bis(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one is sourced from PubChem (CID 3084918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).