About 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one
7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 30849298) has the molecular formula C18H12FN3OS
and a molecular weight of 337.38 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 30849298 |
| Molecular Formula | C18H12FN3OS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2scc(-c3cccc(F)c3)c2ncn1Cc1ccccn1 |
| InChI | InChI=1S/C18H12FN3OS/c19-13-5-3-4-12(8-13)15-10-24-17-16(15)21-11-22(18(17)23)9-14-6-1-2-7-20-14/h1-8,10-11H,9H2 |
| InChIKey | NWPYZOLDDXLQAL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one (CID 30849298) is 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one is O=c1c2scc(-c3cccc(F)c3)c2ncn1Cc1ccccn1.
What is the InChIKey of 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one?
The InChIKey is NWPYZOLDDXLQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FN3OS/c19-13-5-3-4-12(8-13)15-10-24-17-16(15)21-11-22(18(17)23)9-14-6-1-2-7-20-14/h1-8,10-11H,9H2.
What are the key properties of 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one?
7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one has a molecular weight of 337.38 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-fluorophenyl)-3-(pyridin-2-ylmethyl)thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 30849298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).