About (2,5-dichlorophenyl)hydrazine;hydrochloride
(2,5-dichlorophenyl)hydrazine;hydrochloride (PubChem CID 3084937) has the molecular formula C6H7Cl3N2
and a molecular weight of 213.50 g/mol. Its IUPAC name is (2,5-dichlorophenyl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (2,5-dichlorophenyl)hydrazine;hydrochloride |
| PubChem CID | 3084937 |
| Molecular Formula | C6H7Cl3N2 |
| Molecular Weight | 213.50 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | (2,5-dichlorophenyl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C6H6Cl2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
| InChIKey | RQZTURFFWSJCMT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dichlorophenyl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorophenyl)hydrazine;hydrochloride?
The IUPAC name of (2,5-dichlorophenyl)hydrazine;hydrochloride (CID 3084937) is (2,5-dichlorophenyl)hydrazine;hydrochloride.
What is the SMILES notation for (2,5-dichlorophenyl)hydrazine;hydrochloride?
The canonical SMILES for (2,5-dichlorophenyl)hydrazine;hydrochloride is Cl.NNc1cc(Cl)ccc1Cl.
What is the InChIKey of (2,5-dichlorophenyl)hydrazine;hydrochloride?
The InChIKey is RQZTURFFWSJCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H.
What are the key properties of (2,5-dichlorophenyl)hydrazine;hydrochloride?
(2,5-dichlorophenyl)hydrazine;hydrochloride has a molecular weight of 213.50 g/mol, XLogP of 2.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorophenyl)hydrazine;hydrochloride is sourced from PubChem (CID 3084937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).