About 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran
9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran (PubChem CID 3084982) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran.
Molecular Properties
| Compound Name | 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran |
| PubChem CID | 3084982 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran |
| SMILES | COc1c2cccc(C)c2c(C)c2c(C)coc12 |
| InChI | InChI=1S/C16H16O2/c1-9-6-5-7-12-13(9)11(3)14-10(2)8-18-16(14)15(12)17-4/h5-8H,1-4H3 |
| InChIKey | CPUMSSKXMLYDJO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran?
The IUPAC name of 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran (CID 3084982) is 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran.
What is the SMILES notation for 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran?
The canonical SMILES for 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran is COc1c2cccc(C)c2c(C)c2c(C)coc12.
What is the InChIKey of 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran?
The InChIKey is CPUMSSKXMLYDJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2/c1-9-6-5-7-12-13(9)11(3)14-10(2)8-18-16(14)15(12)17-4/h5-8H,1-4H3.
What are the key properties of 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran?
9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran has a molecular weight of 240.30 g/mol, XLogP of 4.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-3,4,5-trimethylbenzo[f][1]benzofuran is sourced from PubChem (CID 3084982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).