About 3-octanoyloxypropyl octanoate
3-octanoyloxypropyl octanoate (PubChem CID 3085110) has the molecular formula C19H36O4
and a molecular weight of 328.49 g/mol. Its IUPAC name is 3-octanoyloxypropyl octanoate.
Molecular Properties
| Compound Name | 3-octanoyloxypropyl octanoate |
| PubChem CID | 3085110 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 3-octanoyloxypropyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCOC(=O)CCCCCCC |
| InChI | InChI=1S/C19H36O4/c1-3-5-7-9-11-14-18(20)22-16-13-17-23-19(21)15-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | XBBMJUWOCGWHRP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octanoyloxypropyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octanoyloxypropyl octanoate?
The IUPAC name of 3-octanoyloxypropyl octanoate (CID 3085110) is 3-octanoyloxypropyl octanoate.
What is the SMILES notation for 3-octanoyloxypropyl octanoate?
The canonical SMILES for 3-octanoyloxypropyl octanoate is CCCCCCCC(=O)OCCCOC(=O)CCCCCCC.
What is the InChIKey of 3-octanoyloxypropyl octanoate?
The InChIKey is XBBMJUWOCGWHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4/c1-3-5-7-9-11-14-18(20)22-16-13-17-23-19(21)15-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of 3-octanoyloxypropyl octanoate?
3-octanoyloxypropyl octanoate has a molecular weight of 328.49 g/mol, XLogP of 5.18, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octanoyloxypropyl octanoate is sourced from PubChem (CID 3085110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).