C33H68 — CID 3085224
2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-hexadecamethylheptadecane (PubChem CID 3085224) has the molecular formula C33H68 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-hexadecamethylheptadecane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-hexadecamethylheptadecane |
|---|---|
| PubChem CID | 3085224 |
| Molecular Formula | C33H68 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.53 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-hexadecamethylheptadecane |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C33H68/c1-26(2,3)19-28(7,8)21-30(11,12)23-32(15,16)25-33(17,18)24-31(13,14)22-29(9,10)20-27(4,5)6/h19-25H2,1-18H3 |
| InChIKey | UCUGLVJQUIRCPK-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |