About 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol
2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 30852306) has the molecular formula C23H25F2N3O
and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol |
| PubChem CID | 30852306 |
| Molecular Formula | C23H25F2N3O |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | OCC[C@H]1CN(Cc2cccc3cnccc23)CCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H25F2N3O/c24-22-5-4-17(12-23(22)25)14-28-10-9-27(16-20(28)7-11-29)15-19-3-1-2-18-13-26-8-6-21(18)19/h1-6,8,12-13,20,29H,7,9-11,14-16H2/t20-/m0/s1 |
| InChIKey | DUBUOPIHLUMKOE-FQEVSTJZSA-N |
| XLogP | 3.58 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol?
The IUPAC name of 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol (CID 30852306) is 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol.
What is the SMILES notation for 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol?
The canonical SMILES for 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol is OCC[C@H]1CN(Cc2cccc3cnccc23)CCN1Cc1ccc(F)c(F)c1.
What is the InChIKey of 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol?
The InChIKey is DUBUOPIHLUMKOE-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H25F2N3O/c24-22-5-4-17(12-23(22)25)14-28-10-9-27(16-20(28)7-11-29)15-19-3-1-2-18-13-26-8-6-21(18)19/h1-6,8,12-13,20,29H,7,9-11,14-16H2/t20-/m0/s1.
What are the key properties of 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol?
2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol has a molecular weight of 397.47 g/mol, XLogP of 3.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-[(3,4-difluorophenyl)methyl]-4-(isoquinolin-5-ylmethyl)piperazin-2-yl]ethanol is sourced from PubChem (CID 30852306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).