About methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate
methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate (PubChem CID 30852454) has the molecular formula C20H28F2N2O3
and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate |
| PubChem CID | 30852454 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CN(Cc2c(F)cccc2F)CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C20H28F2N2O3/c1-26-20(25)6-5-15-13-23(14-16-17(21)3-2-4-18(16)22)8-7-19(15)24-9-11-27-12-10-24/h2-4,15,19H,5-14H2,1H3/t15-,19+/m0/s1 |
| InChIKey | LUZADCIZIRKYSC-HNAYVOBHSA-N |
| XLogP | 2.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate?
The IUPAC name of methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate (CID 30852454) is methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate.
What is the SMILES notation for methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate?
The canonical SMILES for methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate is COC(=O)CC[C@H]1CN(Cc2c(F)cccc2F)CC[C@H]1N1CCOCC1.
What is the InChIKey of methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate?
The InChIKey is LUZADCIZIRKYSC-HNAYVOBHSA-N. The full InChI is InChI=1S/C20H28F2N2O3/c1-26-20(25)6-5-15-13-23(14-16-17(21)3-2-4-18(16)22)8-7-19(15)24-9-11-27-12-10-24/h2-4,15,19H,5-14H2,1H3/t15-,19+/m0/s1.
What are the key properties of methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate?
methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate has a molecular weight of 382.45 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3S,4R)-1-[(2,6-difluorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate is sourced from PubChem (CID 30852454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).