C25H24F3NS — CID 3085262
1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine (PubChem CID 3085262) has the molecular formula C25H24F3NS and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine.
| Compound Name | 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine |
|---|---|
| PubChem CID | 3085262 |
| Molecular Formula | C25H24F3NS |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine |
| SMILES | FC(F)(F)Sc1ccc2c(c1)C(=C1CCN(CC3CC3)CC1)c1ccccc1C=C2 |
| InChI | InChI=1S/C25H24F3NS/c26-25(27,28)30-21-10-9-19-8-7-18-3-1-2-4-22(18)24(23(19)15-21)20-11-13-29(14-12-20)16-17-5-6-17/h1-4,7-10,15,17H,5-6,11-14,16H2 |
| InChIKey | GCRUXZKMBCLCMN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|