C4H7N3O3 — CID 3085372
2-(2-aminoethyl)-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 3085372) has the molecular formula C4H7N3O3 and a molecular weight of 145.12 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-(2-aminoethyl)-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 3085372 |
| Molecular Formula | C4H7N3O3 |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 2-(2-aminoethyl)-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | NCCn1oc(=O)[nH]c1=O |
| InChI | InChI=1S/C4H7N3O3/c5-1-2-7-3(8)6-4(9)10-7/h1-2,5H2,(H,6,8,9) |
| InChIKey | LIPCXBVXQUFCSC-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |