C19H30N8 — CID 30853875
4-[4-[4-[[cyclohexyl(methyl)amino]methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 30853875) has the molecular formula C19H30N8 and a molecular weight of 370.51 g/mol. Its IUPAC name is 4-[4-[4-[[cyclohexyl(methyl)amino]methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[4-[[cyclohexyl(methyl)amino]methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 30853875 |
| Molecular Formula | C19H30N8 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 4-[4-[4-[[cyclohexyl(methyl)amino]methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CN(Cc1cn(C2CCN(c3ccnc(N)n3)CC2)nn1)C1CCCCC1 |
| InChI | InChI=1S/C19H30N8/c1-25(16-5-3-2-4-6-16)13-15-14-27(24-23-15)17-8-11-26(12-9-17)18-7-10-21-19(20)22-18/h7,10,14,16-17H,2-6,8-9,11-13H2,1H3,(H2,20,21,22) |
| InChIKey | JWYJQQPNUYRBQE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |