About [(2R)-2,3-dihydroxypropyl] decanoate
[(2R)-2,3-dihydroxypropyl] decanoate (PubChem CID 3085401) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] decanoate.
Molecular Properties
| Compound Name | [(2R)-2,3-dihydroxypropyl] decanoate |
| PubChem CID | 3085401 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3/t12-/m1/s1 |
| InChIKey | LKUNXBRZDFMZOK-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,3-dihydroxypropyl] decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dihydroxypropyl] decanoate?
The IUPAC name of [(2R)-2,3-dihydroxypropyl] decanoate (CID 3085401) is [(2R)-2,3-dihydroxypropyl] decanoate.
What is the SMILES notation for [(2R)-2,3-dihydroxypropyl] decanoate?
The canonical SMILES for [(2R)-2,3-dihydroxypropyl] decanoate is CCCCCCCCCC(=O)OC[C@H](O)CO.
What is the InChIKey of [(2R)-2,3-dihydroxypropyl] decanoate?
The InChIKey is LKUNXBRZDFMZOK-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3/t12-/m1/s1.
What are the key properties of [(2R)-2,3-dihydroxypropyl] decanoate?
[(2R)-2,3-dihydroxypropyl] decanoate has a molecular weight of 246.35 g/mol, XLogP of 2.02, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydroxypropyl] decanoate is sourced from PubChem (CID 3085401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).